For research use only. Not for therapeutic Use.
Obtusifoliol（Cat No.:M087311）is a naturally occurring sterol found in various plant species, particularly in the biosynthetic pathway of sterols. It serves as an intermediate in the synthesis of essential plant sterols like cholesterol, campesterol, and sitosterol. Obtusifoliol is studied for its role in regulating plant growth and development, as well as for its potential antifungal properties. In addition to its biological significance, it has been explored in phytochemical research for its potential applications in agriculture and medicinal chemistry, including its use as a target in sterol biosynthesis inhibition studies.
| Catalog Number | M087311 |
| CAS Number | 16910-32-0 |
| Molecular Formula | C30H50O |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | Store at -20C |
| IUPAC Name | (3S,4S,5S,10S,13R,14R,17R)-4,10,13,14-tetramethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| InChI | InChI=1S/C30H50O/c1-19(2)20(3)9-10-21(4)23-13-17-30(8)26-12-11-24-22(5)27(31)15-16-28(24,6)25(26)14-18-29(23,30)7/h19,21-24,27,31H,3,9-18H2,1-2,4-8H3/t21-,22+,23-,24+,27+,28+,29-,30+/m1/s1 |
| InChIKey | MMNYKQIDRZNIKT-VSADUBDNSA-N |
| SMILES | C[C@H]1[C@@H]2CCC3=C([C@]2(CC[C@@H]1O)C)CC[C@]4([C@]3(CC[C@@H]4[C@H](C)CCC(=C)C(C)C)C)C |
