For research use only. Not for therapeutic Use.
Ocedurenone is a corticosteroid receptor antagonist. Ocedurenone can be used for the research of kidney disease (WO2018054357, compound I)[1].
Ocedurenone is a corticosteroid receptor antagonist[1].
| Catalog Number | I033791 |
| CAS Number | 1359969-24-6 |
| Synonyms | 4-[(3S,3aR)-3-cyclopentyl-7-(4-hydroxypiperidine-1-carbonyl)-3,3a,4,5-tetrahydropyrazolo[3,4-f]quinolin-2-yl]-2-chlorobenzonitrile |
| Molecular Formula | C28H30ClN5O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C28H30ClN5O2/c29-23-15-19(6-5-18(23)16-30)34-27(17-3-1-2-4-17)22-8-9-24-21(26(22)32-34)7-10-25(31-24)28(36)33-13-11-20(35)12-14-33/h5-7,10,15,17,20,22,27,35H,1-4,8-9,11-14H2/t22-,27-/m0/s1 |
| InChIKey | UXHQLGLGLZKHTC-CUNXSJBXSA-N |
| SMILES | C1CCC(C1)C2C3CCC4=C(C3=NN2C5=CC(=C(C=C5)C#N)Cl)C=CC(=N4)C(=O)N6CCC(CC6)O |
| Reference | [1]. WO2018054357 |
