For research use only. Not for therapeutic Use.
Oct4 inducer-1（Cat No.:R015453）, also known as compound OAC-3, is a potent activator of the Oct4 transcription factor, a key regulator of pluripotency in embryonic stem cells. By activating both Oct4 and Nanog promoters, Oct4 inducer-1 enhances the formation of induced pluripotent stem cells (iPSCs). It facilitates cellular reprogramming by increasing efficiency and shortening the reprogramming time. In studies, Oct4 inducer-1 (1 μM) has been shown to enhance reprogramming efficiency by activating Oct4-luc and Nanog-luc reporters in embryonic stem cells, leading to an increase in iPSC generation and acceleration of iPSC-like colony formation.
| CAS Number | 182564-41-6 |
| Synonyms | 4-fluoro-N-(1H-indol-5-yl)benzamide |
| Molecular Formula | C15H11FN2O |
| Purity | ≥95% |
| IUPAC Name | 4-fluoro-N-(1H-indol-5-yl)benzamide |
| InChI | InChI=1S/C15H11FN2O/c16-12-3-1-10(2-4-12)15(19)18-13-5-6-14-11(9-13)7-8-17-14/h1-9,17H,(H,18,19) |
| InChIKey | RQJUZWRDCVBOMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC3=C(C=C2)NC=C3)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
