For research use only. Not for therapeutic Use.
Octadecanedioic acid diethyl ester(Cat No.:M047450) is a chemical compound derived from the esterification of octadecanedioic acid with ethanol. It consists of a long-chain aliphatic backbone of 18 carbon atoms with carboxylic acid groups at each end, each esterified with an ethyl group. This structure makes it a part of the diester class, known for its applications in the production of synthetic lubricants, plasticizers, and solvents. Its properties include low volatility and high boiling points, making it suitable for industrial uses that require stable, non-volatile components in their formulations.
CAS Number | 1472-90-8 |
Synonyms | Octadecanedioic acid diethyl ester |
Molecular Formula | C22H42O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | diethyl octadecanedioate |
InChI | InChI=1S/C22H42O4/c1-3-25-21(23)19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-22(24)26-4-2/h3-20H2,1-2H3 |
InChIKey | LGGDSXPOQVDFDO-UHFFFAOYSA-N |
SMILES | CCOC(=O)CCCCCCCCCCCCCCCCC(=O)OCC |