For research use only. Not for therapeutic Use.
Octadecanoyl fluoride(CAT: L000272) is a compound with notable applications in material chemistry. This chemical is used as a precursor in the synthesis of functionalized materials and coatings. Its action method involves reacting with other compounds to introduce octadecanoyl groups into various materials, enhancing their properties such as hydrophobicity.
CAS Number | 1511-79-1 |
Molecular Formula | C18H35FO |
Purity | ≥95% |
IUPAC Name | octadecanoyl fluoride |
InChI | InChI=1S/C18H35FO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3 |
InChIKey | ULGHGPGLVYEVQV-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |