For research use only. Not for therapeutic Use.
Octadecanoyl fluoride(CAT: L000272) is a compound with notable applications in material chemistry. This chemical is used as a precursor in the synthesis of functionalized materials and coatings. Its action method involves reacting with other compounds to introduce octadecanoyl groups into various materials, enhancing their properties such as hydrophobicity.
| Catalog Number | L000272 |
| CAS Number | 1511-79-1 |
| Molecular Formula | C18H35FO |
| Purity | ≥95% |
| IUPAC Name | octadecanoyl fluoride |
| InChI | InChI=1S/C18H35FO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3 |
| InChIKey | ULGHGPGLVYEVQV-UHFFFAOYSA-N |
