For research use only. Not for therapeutic Use.
Octahydro-1H-pyrrolo[3,2-b]pyridine(Cat No.:L007688), is a chemical compound featuring a bicyclic structure with a pyrrolidine and piperidine ring fusion. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a valuable building block in the creation of diverse organic molecules, especially in the development of pharmaceuticals and fine chemicals. Its unique structure allows for various chemical modifications, making it valuable in the design and synthesis of novel compounds for drug discovery, research purposes, and industrial applications. It contributes to advancements in medicinal chemistry research, enabling the development of potential therapeutic agents and organic compounds for various applications.
CAS Number | 1393546-65-0 |
Molecular Formula | C7H14N2 |
Purity | ≥95% |
IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-b]pyridine |
InChI | InChI=1S/C7H14N2/c1-2-6-7(8-4-1)3-5-9-6/h6-9H,1-5H2 |
InChIKey | IJVGODUTGYOVKR-UHFFFAOYSA-N |
SMILES | C1CC2C(CCN2)NC1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |