For research use only. Not for therapeutic Use.
Octamethylpyrophosphoramide（Cat No.:M069285）, commonly referred to as OMPA, is a phosphorus-containing organic compound characterized by its structure with two amide groups linked by a pyrophosphate bond. This chemical is known for its use as a potent inhibitor of acetylcholinesterase, an enzyme that breaks down the neurotransmitter acetylcholine. Due to its inhibitory activity on this enzyme, OMPA has been studied for its potential applications in the treatment of conditions involving cholinergic systems, such as Alzheimer’s disease. However, its use is primarily limited to research environments because of its toxicity and potential side effects.
| Catalog Number | M069285 |
| CAS Number | 152-16-9 |
| Synonyms | Schradan, Octamethyldiphosphoramide, OMPA, Pestox, Systam |
| Molecular Formula | C8H24N4O3P2 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | N-[bis(dimethylamino)phosphoryloxy-(dimethylamino)phosphoryl]-N-methylmethanamine |
| InChI | InChI=1S/C8H24N4O3P2/c1-9(2)16(13,10(3)4)15-17(14,11(5)6)12(7)8/h1-8H3 |
| InChIKey | SZKKRCSOSQAJDE-UHFFFAOYSA-N |
| SMILES | CN(C)P(=O)(N(C)C)OP(=O)(N(C)C)N(C)C |
