For research use only. Not for therapeutic Use.
Octanal-d16(Cat No.:R047809) is a deuterated form of octanal, where all sixteen hydrogen atoms are replaced with deuterium. This isotopic modification significantly enhances the compound’s stability and makes it particularly useful for analytical and spectroscopic studies, such as NMR and mass spectrometry. Octanal is an aldehyde commonly used in the flavor and fragrance industries, and it also serves as an important intermediate in chemical synthesis. The deuterated version, Octanal-d16, provides more accurate and detailed insights into the metabolic pathways and reaction mechanisms of octanal, aiding in the development of better products and processes in various industries.
Catalog Number | R047809 |
CAS Number | 1219794-66-7 |
Synonyms | Aldehyde C8-d16; Antifoam LF-d16; Caprylaldehyde-d16; Caprylic Aldehyde-d16; NSC 1508-d16; NSC 8969-d16; Octaldehyde-d16; Octanaldehyde-d16; Octanoic Aldehyde-d16; Octylaldehyde-d16; n-Caprylaldehyde-d16; n-Octaldehyde-d16; n-Octanal-d16; n-Octyl Ald |
Molecular Formula | C8H16O |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | -20°C |
IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecadeuteriooctan-1-one |
InChI | InChI=1S/C8H16O/c1-2-3-4-5-6-7-8-9/h8H,2-7H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D |
InChIKey | NUJGJRNETVAIRJ-ZEFOBESCSA-N |
SMILES | [2H]C(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |