For research use only. Not for therapeutic Use.
Octanoic acid-d15（Cat No.:S000767） is a deuterium-labeled version of octanoic acid, also known as caprylic acid, a medium-chain fatty acid found in coconut oil and palm kernel oil. The chemical formula for this compound is C8HD15O2, where fifteen hydrogen atoms are replaced with deuterium. This isotopic labeling enhances the compound’s properties for use in scientific research, particularly in spectroscopic studies like NMR and mass spectrometry, providing clearer, more distinct signals. Octanoic acid-d15 is widely used in metabolic studies to explore fatty acid metabolism and energy production mechanisms in biological systems.
| Catalog Number | S000767 |
| CAS Number | 69974-55-6 |
| Molecular Formula | C8HD15O2 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecadeuteriooctanoic acid |
| InChI | InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2 |
| InChIKey | WWZKQHOCKIZLMA-PMELWRBQSA-N |
| SMILES | CCCCCCCC(=O)O |
