For research use only. Not for therapeutic Use.
Octhilinone, also known as 2-octyl-4-isothiazolin-3-one, is a powerful biocide widely used in industrial and consumer products for its antimicrobial properties. This compound is essential for controlling microbial growth in paints, adhesives, and personal care products. Its effectiveness in preventing mold and bacterial contamination makes it a valuable component in preserving product integrity. Octhilinone is highly valued for its stability and broad-spectrum activity, making it indispensable for ensuring hygiene and longevity in various applications.
| Catalog Number | R006549 |
| CAS Number | 26530-20-1 |
| Synonyms | 2-Octyl-4-isothiazolin-3-one; 2-Octyl-3(2H)-isothiazolone; Pancil; RH 893; SD 888; Skane 8; Kathon; |
| Molecular Formula | C11H19NOS |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-octyl-1,2-thiazol-3-one |
| InChI | InChI=1S/C11H19NOS/c1-2-3-4-5-6-7-9-12-11(13)8-10-14-12/h8,10H,2-7,9H2,1H3 |
| InChIKey | JPMIIZHYYWMHDT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN1C(=O)C=CS1 |
