For research use only. Not for therapeutic Use.
Octylonium-d3 Bromide(Cat No.:R057801) is a deuterated compound featuring three deuterium atoms, essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of Octylonium Bromide is crucial for studying its pharmacokinetics, metabolic pathways, and receptor interactions, particularly in gastrointestinal research. Its stable isotope labeling ensures precise and reliable analytical results, making it ideal for mass spectrometry and NMR applications. With enhanced stability and consistency, Octylonium-d3 Bromide integrates seamlessly into various experimental setups, providing a robust solution for high-precision scientific investigations.
CAS Number | NA |
Synonyms | N,N-Diethyl-N-(methy-d3)-2-[[4-[[2-(octyloxy)benzoyl]amino]benzoyl]oxy]ethanaminium Bromide; Otilonium-d3 Bromide; SP-63-d3; Doralin-d3; Menoctyl-d3; Pasminox-d3; Spasen-d3; Spasmoctyl-d3; Spasmomen-d3; |
Molecular Formula | C₂₉H₄₀D₃N₂O₄ |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | diethyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]-(trideuteriomethyl)azanium;bromide |
InChI | InChI=1S/C29H42N2O4.BrH/c1-5-8-9-10-11-14-22-34-27-16-13-12-15-26(27)28(32)30-25-19-17-24(18-20-25)29(33)35-23-21-31(4,6-2)7-3;/h12-13,15-20H,5-11,14,21-23H2,1-4H3;1H/i4D3; |
InChIKey | VWZPIJGXYWHBOW-NXIGQQGZSA-N |
SMILES | [2H]C([2H])([2H])[N+](CC)(CC)CCOC(=O)C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2OCCCCCCCC.[Br-] |