OG-L002（Cat No.:R061201）is a selective inhibitor of the histone methyltransferase SETD2, which is involved in the regulation of gene expression through the trimethylation of histone H3 at lysine 36 (H3K36me3). By targeting SETD2, OG-L002 can influence DNA damage repair and transcriptional regulation, making it significant in cancer biology, especially in tumors with altered SETD2 function. Preclinical studies have indicated its potential to inhibit tumor growth and sensitize cancer cells to chemotherapy. OG-L002’s unique mechanism highlights its promise as a therapeutic agent in targeted cancer treatments and epigenetic research.
| Catalog Number | R061201 |
| CAS Number | 1357302-64-7 |
| Synonyms | 4’-[(1R,2S)-2-Aminocyclopropyl]-[1,1’-biphenyl]-3-ol; 4’-((1R,2S)-2-Aminocyclopropyl)biphenyl-3-ol |
| Molecular Formula | C15H15NO |
| Purity | ≥95% |
| Target | Histone Demethylases |
| Solubility | >11.3mg/mL in DMSO |
| Storage | Store at -20C |
| IUPAC Name | 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol |
| InChI | InChI=1S/C15H15NO/c16-15-9-14(15)11-6-4-10(5-7-11)12-2-1-3-13(17)8-12/h1-8,14-15,17H,9,16H2/t14-,15+/m1/s1 |
| InChIKey | DSOJSZXQRJGBCW-CABCVRRESA-N |
| SMILES | C1[C@@H]([C@H]1N)C2=CC=C(C=C2)C3=CC(=CC=C3)O |
