For research use only. Not for therapeutic Use.
OK2(CAT: I040976) is a specific inhibitor that targets the interaction between Connective Tissue Growth Factor (CCN2) and the Epidermal Growth Factor Receptor (EGFR). By binding to the CT domain of CCN2, OK2 effectively disrupts the CCN2/EGFR interaction, leading to the inhibition of EGFR activation, STAT3 phosphorylation, and extracellular matrix (ECM) protein synthesis. These processes are crucial in the development of kidney fibrosis. In vivo studies have demonstrated that OK2 can impede kidney fibrosis in mouse models, suggesting its potential as a therapeutic agent for chronic kidney disease. Given its mechanism of action, OK2 is most relevant to Inflammation & Immunology Research, particularly in the context of fibrotic diseases.
| Catalog Number | I040976 |
| Synonyms | 2-[3-[(3S,6S,9S,12S,15S,18S,21S)-9-(4-aminobutyl)-12,15-bis[(1R)-1-hydroxyethyl]-6-(1H-imidazol-5-ylmethyl)-18-(1H-indol-3-ylmethyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazabicyclo[19.3.0]tetracosan-3-yl]propyl]guanidine |
| Molecular Formula | C42H62N14O9 |
| Purity | ≥95% |
| InChI | InChI=1S/C42H62N14O9/c1-22(57)33-39(63)50-28(11-5-6-14-43)35(59)52-31(18-25-20-46-21-49-25)36(60)51-29(12-7-15-47-42(44)45)41(65)56-16-8-13-32(56)38(62)53-30(37(61)54-34(23(2)58)40(64)55-33)17-24-19-48-27-10-4-3-9-26(24)27/h3-4,9-10,19-23,28-34,48,57-58H,5-8,11-18,43H2,1-2H3,(H,46,49)(H,50,63)(H,51,60)(H,52,59)(H,53,62)(H,54,61)(H,55,64)(H4,44,45,47)/t22-,23-,28+,29+,30+,31+,32+,33+,34+/m1/s1 |
| InChIKey | DNITVPPEDHWZSB-MLYITYKWSA-N |
| SMILES | CC(C1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)N1)CC3=CNC4=CC=CC=C43)CCCN=C(N)N)CC5=CN=CN5)CCCCN)C(C)O)O |
