Olanzapine（Cat No.:A000340）is an atypical antipsychotic used to treat schizophrenia, bipolar disorder, and treatment-resistant depression. It works by modulating neurotransmitter activity, particularly dopamine and serotonin, helping to reduce psychotic symptoms like hallucinations, delusions, and mood instability. Olanzapine is known for its effectiveness in managing both the positive and negative symptoms of schizophrenia, as well as manic and depressive episodes in bipolar disorder. While it is highly effective, olanzapine is associated with side effects such as weight gain and metabolic changes, which require monitoring during long-term use.
| Catalog Number | A000340 |
| CAS Number | 132539-06-1 |
| Synonyms | 132539-06-1; Zyprexa; Zyprexa Zydis; Olansek; Zalasta |
| Molecular Formula | C17H20N4S |
| Purity | 98% |
| Target | 5-HT Receptor |
| Target Protein | |
| Solubility | >15.6mg/mL in DMSO |
| Appearance | Solid |
| Storage | Dry, dark and at 2 - 8 °C for six months or -20°C for two years. |
| IC50 | 5-HT2A Receptor：4 nM (Ki) |
| IUPAC Name | 2-methyl-4-(4-methylpiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepine |
| InChI | InChI=1S/C17H20N4S/c1-12-11-13-16(21-9-7-20(2)8-10-21)18-14-5-3-4-6-15(14)19-17(13)22-12/h3-6,11,19H,7-10H2,1-2H3 |
| InChIKey | KVWDHTXUZHCGIO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)NC3=CC=CC=C3N=C2N4CCN(CC4)C |
| Reference | 1: Bever KA, Perry PJ. Olanzapine: a serotonin-dopamine-receptor antagonist for 2: Fulton B, Goa KL. Olanzapine. A review of its pharmacological properties and 3: Littrell K, Peabody CD, Littrell SH. Olanzapine: a new atypical antipsychotic. 4: Meltzer HY, Fibiger HC. Olanzapine: a new typical antipsychotic drug. |
