For research use only. Not for therapeutic Use.
Olaparib(Cat No.:I004823) is a poly (ADP-ribose) polymerase (PARP) inhibitor used as an anticancer agent, particularly in the treatment of cancers with BRCA1 or BRCA2 mutations, such as ovarian, breast, and prostate cancers. By inhibiting the PARP enzyme, Olaparib prevents the repair of single-strand DNA breaks, leading to the accumulation of DNA damage and ultimately causing cancer cell death. This mechanism is especially effective in cancer cells deficient in homologous recombination repair, such as those with BRCA mutations. Olaparib is used as part of targeted cancer therapy, and its ability to exploit the weaknesses in DNA repair mechanisms makes it a powerful tool in precision oncology.
| Catalog Number | I004823 |
| CAS Number | 763113-22-0 |
| Synonyms | AZD2281; KU-0059436; KU0059436; AZD-2281; KU0059436; AZD 2281 |
| Molecular Formula | C₂₄H₂₃FN₄O₃ |
| Purity | ≥95% |
| Target | PARP |
| Solubility | DMSO: ≥ 34 mg/mL |
| Storage | 3 years -20C powder |
| IC50 | 5 nM(PARP-1); 1 nM(PARP-2) |
| IUPAC Name | 4-[[3-[4-(cyclopropanecarbonyl)piperazine-1-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
| InChI | InChI=1S/C24H23FN4O3/c25-20-8-5-15(14-21-17-3-1-2-4-18(17)22(30)27-26-21)13-19(20)24(32)29-11-9-28(10-12-29)23(31)16-6-7-16/h1-5,8,13,16H,6-7,9-12,14H2,(H,27,30) |
| InChIKey | FDLYAMZZIXQODN-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)N2CCN(CC2)C(=O)C3=C(C=CC(=C3)CC4=NNC(=O)C5=CC=CC=C54)F |
