For research use only. Not for therapeutic Use.
Oleamide(Cat No.:R000341) is an oleic acid derivative and a fatty acid primary amide naturally found in the brain and other tissues. It is known for its role as a signaling molecule in the central nervous system, where it modulates various neurotransmitter systems, including serotonin and dopamine. Oleamide is also involved in the regulation of sleep, appetite, and mood. Additionally, oleamide exhibits interesting physical properties, such as its ability to reduce friction and wear, leading to its use as a lubricant additive. Oleamide’s diverse functions and potential therapeutic effects make it a subject of ongoing research in neuroscience and other fields.
CAS Number | 301-02-0 |
Synonyms | cis-9,10-Octadecenoamide; Oleylamide; Oleic Acid Amide; Crodamide O; Adogen 73; Neutron (amide); Kemamide U; Unislip 1759; |
Molecular Formula | C18H35NO |
Purity | ≥95% |
Target | Endogenous Metabolite |
Solubility | Soluble in DMSO > 10 mM |
Storage | Store at +4C |
IUPAC Name | (Z)-octadec-9-enamide |
InChI | InChI=1S/C18H35NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H2,19,20)/b10-9- |
InChIKey | FATBGEAMYMYZAF-KTKRTIGZSA-N |
SMILES | CCCCCCCCC=CCCCCCCCC(=O)N |