For research use only. Not for therapeutic Use.
Oleanolic acid 3-O-monoglucuronide(Cat N0.:M004933) is a glucuronidated derivative of oleanolic acid, a naturally occurring triterpenoid known for its therapeutic properties. This modification involves attaching a glucuronic acid molecule to the third hydroxyl group of oleanolic acid via an ester linkage. This glucuronidation enhances the compound’s solubility in water and facilitates its excretion from the body, which is crucial for its use as a bioactive compound in pharmacological applications. Oleanolic acid and its derivatives exhibit anti-inflammatory, hepatoprotective, and antitumor activities, making them of significant interest in the development of new drugs and health supplements.
CAS Number | 108322-31-2 |
Synonyms | oleanolic acid 3-O-monoglucuronide |
Molecular Formula | C36H56O9 |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-8a-carboxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
InChI | InChI=1S/C36H56O9/c1-31(2)14-16-36(30(42)43)17-15-34(6)19(20(36)18-31)8-9-22-33(5)12-11-23(32(3,4)21(33)10-13-35(22,34)7)44-29-26(39)24(37)25(38)27(45-29)28(40)41/h8,20-27,29,37-39H,9-18H2,1-7H3,(H,40,41)(H,42,43)/t20-,21-,22+,23-,24-,25-,26+,27-,29+,33-,34+,35+,36-/m0/s1 |
InChIKey | IUCHKMAZAWJNBJ-RCYXVVTDSA-N |
SMILES | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC6C(C(C(C(O6)C(=O)O)O)O)O)C)C)C2C1)C)C(=O)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |