Oleic Acid-¹³C is an isotopically labeled form of oleic acid, with the carbon-13 isotope incorporated into its molecular structure. This compound is particularly valuable in lipidomics, metabolic research, and nutritional studies. The carbon-13 labeling allows for enhanced detection and precise tracking of oleic acid in metabolic pathways using NMR spectroscopy and mass spectrometry. Oleic Acid-¹³C is essential for investigating the dynamics of fatty acid metabolism, including its role in energy production, membrane structure, and signaling pathways. Its high purity and stability ensure reliable and consistent performance in a variety of experimental setups, making it a crucial tool for researchers studying lipid metabolism, cardiovascular health, and related fields.
| Catalog Number | R000347 |
| CAS Number | 82005-44-5 |
| Synonyms | (Z)-9-Octadecenoic Acid-13C; 9Δ-cis-Octadecenoic Acid-13C; |
| Molecular Formula | C18H34O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (Z)-(113C)octadec-9-enoic acid |
| InChI | InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9-/i18+1 |
| InChIKey | ZQPPMHVWECSIRJ-OLLJCFGNSA-N |
| SMILES | CCCCCCCC/C=C\CCCCCCC[13C](=O)O |
