For research use only. Not for therapeutic Use.
Oleic acid (Cat. No: R054837) isa monounsaturated omega-9 fatty acid widely found in plant and animal fats, particularly in olive oil. It plays a significant role in cellular membrane structure and function, enhancing membrane fluidity and signaling processes. Oleic acid exhibits anti-inflammatory, antioxidant, and cardioprotective properties, making it valuable in studies of metabolic disorders, cardiovascular health, and cancer. Additionally, it serves as a precursor for various lipids and is investigated for its role in improving insulin sensitivity, reducing LDL cholesterol, and supporting overall metabolic health.
CAS Number | 112-80-1 |
Synonyms | (9Z)-9-Octadecenoic Acid; cis-9-Octadecenoic Acid; |
Molecular Formula | C18H34O2 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | -20°C |
IUPAC Name | (Z)-octadec-9-enoic acid |
InChI | InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- |
InChIKey | ZQPPMHVWECSIRJ-KTKRTIGZSA-N |
SMILES | CCCCCCCCC=CCCCCCCCC(=O)O |