For research use only. Not for therapeutic Use.
Oleoyl chloride (Cat No.:R026443) is an organic compound derived from oleic acid, where the carboxyl group is converted to an acyl chloride group. It is used primarily in organic synthesis, particularly for the preparation of surfactants, detergents, and emulsifiers. Oleoyl chloride is also employed in the production of various oleyl derivatives, which have applications in the manufacturing of lubricants, pharmaceuticals, and coatings. Additionally, it plays a role in the modification of proteins, lipids, and polymers, providing functional groups for further chemical reactions and research in materials science.
| Catalog Number | R026443 |
| CAS Number | 112-77-6 |
| Synonyms | (Z)-octadec-9-enoyl chloride |
| Molecular Formula | C18H33ClO |
| Purity | ≥95% |
| IUPAC Name | (Z)-octadec-9-enoyl chloride |
| InChI | InChI=1S/C18H33ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3/b10-9- |
| InChIKey | MLQBTMWHIOYKKC-KTKRTIGZSA-N |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Cl |
