For research use only. Not for therapeutic Use.
Oleoyl Coenzyme A Lithium(Cat No.:M042611)is a long-chain fatty acyl-CoA derivative involved in lipid metabolism, β-oxidation, and signal transduction. It plays a crucial role in fatty acid synthesis, energy production, and membrane lipid remodeling. As an essential intermediate in triacylglycerol and phospholipid biosynthesis, it contributes to cellular homeostasis and metabolic regulation. Oleoyl-CoA is also a key regulator of enzymes such as acetyl-CoA carboxylase and carnitine palmitoyltransferase-1 (CPT1), influencing fatty acid oxidation. The lithium salt form improves solubility and stability, making it ideal for biochemical assays and metabolic disease research.
CAS Number | 188824-37-5 |
Molecular Formula | C39H68LiN7O17P3S |
Purity | ≥95% |
InChI | InChI=1S/C39H68N7O17P3S.Li/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-30(48)67-23-22-41-29(47)20-21-42-37(51)34(50)39(2,3)25-60-66(57,58)63-65(55,56)59-24-28-33(62-64(52,53)54)32(49)38(61-28)46-27-45-31-35(40)43-26-44-36(31)46;/h11-12,26-28,32-34,38,49-50H,4-10,13-25H2,1-3H3,(H,41,47)(H,42,51)(H,55,56)(H,57,58)(H2,40,43,44)(H2,52,53,54);/b12-11-;/t28-,32-,33-,34+,38-;/m1./s1 |
InChIKey | PHQSZFRUVQXHNS-NMGRLVKYSA-N |
SMILES | [Li].CCCCCCCC/C=C\CCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |