For research use only. Not for therapeutic Use.
Oleoyl-L-α-lysophosphatidic acid sodium salt(Cat No.:R027613), is a chemical compound used in various biochemical and pharmaceutical applications. It is a derivative of lysophosphatidic acid (LPA) containing an oleoyl group and a sodium salt. LPA is a bioactive lipid molecule involved in various cellular processes, including cell proliferation, migration, and signaling. This specific compound, with its oleoyl modification, is of interest in the study of lipid signaling pathways and membrane biology. It may also have potential therapeutic applications due to its role in cellular communication and its ability to modulate specific physiological responses in various tissues and cells.
CAS Number | 22556-62-3 |
Synonyms | (9Z)-9-Octadecenoic Acid 2-Hydroxy-3-(phosphonooxy)propyl Ester Sodium Salt; (9Z)-9-Octadecenoic Acid 2-Hydroxy-3-(phosphonooxy)propyl Ester Monosodium Salt; (Z)-9-Octadecenoic Acid 2-Hydroxy-3-(phosphonooxy)propyl Ester Monosodium Salt; 1-Mono-olein |
Molecular Formula | C21H40O7P • Na |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | sodium;[2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropyl] hydrogen phosphate |
InChI | InChI=1S/C21H41O7P.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(23)27-18-20(22)19-28-29(24,25)26;/h9-10,20,22H,2-8,11-19H2,1H3,(H2,24,25,26);/q;+1/p-1/b10-9-; |
InChIKey | XGRLSUFHELJJAB-KVVVOXFISA-M |
SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)[O-])O.[Na+] |