For research use only. Not for therapeutic Use.
Oleoyl-L-carnitine is a compound that combines the long-chain fatty acid oleic acid with L-carnitine, a molecule involved in the transport of fatty acids into mitochondria for energy production. This conjugation enhances the lipid-soluble properties of L-carnitine, facilitating the efficient transport and metabolism of fatty acids. Oleoyl-L-carnitine is studied for its potential benefits in improving energy metabolism and is of interest in research related to cardiovascular health, weight management, and mitochondrial disorders.
| CAS Number | 38677-66-6 |
| Synonyms | (2R)-3-Carboxy-N,N,N-trimethyl-2-[[(9Z)-1-oxo-9-octadecen-1-yl]oxy]-,1-propanaminium inner salt?[R-(Z)]-3-Carboxy-N,N,N-trimethyl-2-[(1-oxo-9-octadecenyl)oxy]-1-propanaminium inner salt(2R)-3-Carboxy-N,N,N-trimethyl-2-[[(9Z)-1-oxo-9-octadecenyl]oxy]- |
| Molecular Formula | C25H47NO4 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | Store at -80C |
| IUPAC Name | (3R)-3-[(Z)-octadec-9-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
| InChI | InChI=1S/C25H47NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25(29)30-23(21-24(27)28)22-26(2,3)4/h12-13,23H,5-11,14-22H2,1-4H3/b13-12-/t23-/m1/s1 |
| InChIKey | IPOLTUVFXFHAHI-WHIOSMTNSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
