For research use only, not for therapeutic use.
Olsalazine（Cat No.:M083664）is a high-purity anti-inflammatory drug used primarily in the treatment of ulcerative colitis. It acts as a prodrug, converting into two molecules of 5-aminosalicylic acid (5-ASA) in the colon, which directly reduces inflammation. Olsalazine is crucial for managing symptoms and maintaining remission in inflammatory bowel disease patients. Its targeted delivery ensures minimal systemic absorption and reduced side effects compared to other treatments. This compound’s effectiveness in colonic inflammation makes it an essential therapeutic agent in gastroenterology, significantly improving patient quality of life.
| Catalog Number | M083664 |
| CAS Number | 15722-48-2 |
| Molecular Formula | C14H10N2O6 |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | 5-[(3-carboxy-4-hydroxyphenyl)diazenyl]-2-hydroxybenzoic acid |
| InChI | InChI=1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22) |
| InChIKey | QQBDLJCYGRGAKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=NC2=CC(=C(C=C2)O)C(=O)O)C(=O)O)O |
