For research use only. Not for therapeutic Use.
Olvanil(CAT: I010336) is a synthetic analog of capsaicin and a potent agonist of the transient receptor potential vanilloid 1 (TRPV1) receptor. Unlike capsaicin, Olvanil exhibits reduced pungency while retaining its ability to activate TRPV1, making it an ideal candidate for pain management research. By modulating TRPV1 activity, it influences nociceptive signaling, providing insights into pain pathways and potential therapeutic interventions. Olvanil is particularly relevant in neurological research, where it supports the study of neuropathic pain and inflammatory conditions. Its unique properties enable researchers to explore TRPV1-targeted treatments with enhanced patient tolerability and efficacy.
| Catalog Number | I010336 |
| CAS Number | 58493-49-5 |
| Synonyms | Alternative Name: NE 19550 |
| Molecular Formula | C26H43NO3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 100 mM in DMSO and to 25 mM in ethanol |
| Storage | Desiccate at -20°C |
| IUPAC Name | (Z)-N-[(4-hydroxy-3-methoxyphenyl)methyl]octadec-9-enamide |
| InChI | InChI=1S/C26H43NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-26(29)27-22-23-19-20-24(28)25(21-23)30-2/h10-11,19-21,28H,3-9,12-18,22H2,1-2H3,(H,27,29)/b11-10- |
| InChIKey | OPZKBPQVWDSATI-KHPPLWFESA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
