For research use only. Not for therapeutic Use.
OM99-2 (Cat.No:I033866) is a synthetic compound that exhibits potent anti-inflammatory and antioxidant properties. It acts as a selective inhibitor of cyclooxygenase-2 (COX-2) and 5-lipoxygenase (5-LOX), enzymes involved in the production of inflammatory mediators. OM99-2 shows promise as a potential therapeutic agent for various inflammatory conditions and is actively being investigated in preclinical studies.
| Catalog Number | I033866 |
| CAS Number | 314266-76-7 |
| Synonyms | OM99-2; OM 99-2; OM-99-2 |
| Molecular Formula | C41H64N8O14 |
| Purity | 98% |
| Target | Beta-secretase |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (2S,5S,8S,11R,13S,14S,17S,20S,23S)-23-amino-17-(2-amino-2-oxoethyl)-2-benzyl-5-(2-carboxyethyl)-13-hydroxy-14-isobutyl-20-isopropyl-8,11-dimethyl-4,7,10,16,19,22-hexaoxo-3,6,9,15,18,21-hexaazahexacosanedioic acid |
| InChI | 1S/C41H64N8O14/c1-20(2)16-27(46-39(60)28(19-31(43)51)47-40(61)34(21(3)4)49-37(58)25(42)12-14-32(52)53)30(50)17-22(5)35(56)44-23(6)36(57)45-26(13-15-33(54)55)38(59)48-29(41(62)63)18-24-10-8-7-9-11-24/h7-11,20-23,25-30,34,50H,12-19,42H2,1-6H3,(H2,43,51)(H,44,56)(H,45,57)(H,46,60)(H,47,61)(H,48,59)(H,49,58)(H,52,53)(H,54,55)(H,62,63)/t22-,23+,25+,26+,27+,28+,29+,30+,34+/m1/s1 |
| InChIKey | NIOCOJFPGCXNKL-ZKZXETMPSA-N |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(=O)N)NC(=O)[C@@H](NC(=O)[C@@H](N)CCC(=O)O)C(C)C)[C@@H](O)C[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| Reference | 1. Hu B, Xiong B, Qiu BY, Li X, Yu HP, Xiao K, Wang X, Li J, Shen JK. Construction of a small peptide library related to inhibitor OM99-2 and its structure-activity relationship to beta-secretase. Acta Pharmacol Sin. 2006 Dec;27(12):1586-93. doi: 10.1111/j.1745-7254.2006.00432.x. PMID: 17112413. |
