For research use only. Not for therapeutic Use.
Omaciclovir (CAT: M130307) is an antiviral drug primarily used for the treatment of herpesvirus infections. It works by inhibiting viral DNA replication, specifically targeting the enzymes responsible for viral genome synthesis. Omaciclovir is structurally related to other antiviral agents like acyclovir and ganciclovir but is noted for its potency against varicella-zoster virus (VZV), the virus responsible for chickenpox and shingles. Despite its effectiveness, omaciclovir’s clinical use has been limited due to potential interactions with certain cancer drugs, leading to toxic side effects. It is of interest in research for its unique mechanism and selective antiviral activity.
| Catalog Number | M130307 |
| CAS Number | 124265-89-0 |
| Molecular Formula | C10H15N5O3 |
| Purity | ≥95% |
| Target | HSV |
| Storage | Store at RT |
| IUPAC Name | 2-amino-9-[(2R)-4-hydroxy-2-(hydroxymethyl)butyl]-3H-purin-6-one |
| InChI | InChI=1S/C10H15N5O3/c11-10-13-8-7(9(18)14-10)12-5-15(8)3-6(4-17)1-2-16/h5-6,16-17H,1-4H2,(H3,11,13,14,18)/t6-/m1/s1 |
| InChIKey | SCBFBAWJWLXVHS-ZCFIWIBFSA-N |
| SMILES | C1=NC2=C(N1CC(CCO)CO)NC(=NC2=O)N |
