For research use only. Not for therapeutic Use.
Ombuin(Cat No.:R052754)is a naturally occurring flavonoid found in plants like Rhamnus erythroxylon and Zanthoxylum armatum, known for its anti-inflammatory, antioxidant, and antimicrobial properties. Studies suggest ombuin can inhibit pro-inflammatory cytokine release and reduce oxidative stress, offering potential benefits for managing neuroinflammation and oxidative damage. Additionally, ombuin has shown antibacterial effects, with research indicating its effectiveness against a range of bacterial strains. Its diverse bioactivities make it a promising candidate for further exploration in natural medicine and pharmacology as a therapeutic agent.
CAS Number | 529-40-8 |
Molecular Formula | C17H14O7 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | 3,5-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxychromen-4-one |
InChI | InChI=1S/C17H14O7/c1-22-9-6-11(19)14-13(7-9)24-17(16(21)15(14)20)8-3-4-12(23-2)10(18)5-8/h3-7,18-19,21H,1-2H3 |
InChIKey | BWORNNDZQGOKBY-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC)O)O)O |