For research use only. Not for therapeutic Use.
Ombuoside(Cat No.:R064390)is a bioactive flavonoid glycoside, commonly found in plants such as Erythrina species, known for its antioxidant and anti-inflammatory properties. This compound has garnered interest for its potential health benefits, particularly in cardiovascular and metabolic health research, due to its ability to neutralize free radicals and reduce oxidative stress. Ombuoside also shows promise in studies focused on immune modulation and anti-aging, making it valuable in nutraceutical and pharmaceutical applications. As a naturally occurring compound, it is investigated for its therapeutic potential in chronic disease prevention and wellness support.
Catalog Number | R064390 |
CAS Number | 20188-85-6 |
Molecular Formula | C29H34O16 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
InChI | InChI=1S/C29H34O16/c1-10-19(32)22(35)24(37)28(42-10)41-9-17-20(33)23(36)25(38)29(44-17)45-27-21(34)18-14(31)7-12(39-2)8-16(18)43-26(27)11-4-5-15(40-3)13(30)6-11/h4-8,10,17,19-20,22-25,28-33,35-38H,9H2,1-3H3/t10-,17+,19-,20+,22+,23-,24+,25+,28+,29-/m0/s1 |
InChIKey | VVSFMIXQNYRGMG-BDAFLREQSA-N |
SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)OC)C5=CC(=C(C=C5)OC)O)O)O)O)O)O)O |