For research use only. Not for therapeutic Use.
ONO-1301 is a potent prostaglandin I2 (PGI2) mimetic and thromboxane A2 receptor antagonist, primarily used in cardiovascular research. It exerts dual effects by promoting vasodilation and inhibiting platelet aggregation, making it beneficial for preventing thrombosis and improving blood flow. Additionally, ONO-1301 stimulates tissue regeneration by enhancing the production of vascular endothelial growth factor (VEGF), which can support tissue repair and recovery in conditions like myocardial infarction or ischemic injury. Its ability to protect against vascular damage and promote healing makes ONO-1301 a promising candidate in developing therapies for cardiovascular diseases and tissue regeneration.
| Catalog Number | I008455 |
| CAS Number | 176391-41-6 |
| Synonyms | 2-[[5-[2-[(E)-[phenyl(pyridin-3-yl)methylidene]amino]oxyethyl]-7,8-dihydronaphthalen-1-yl]oxy]acetic acid |
| Molecular Formula | C26H24N2O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C26H24N2O4/c29-25(30)18-31-24-13-5-11-22-19(9-4-12-23(22)24)14-16-32-28-26(20-7-2-1-3-8-20)21-10-6-15-27-17-21/h1-3,5-11,13,15,17H,4,12,14,16,18H2,(H,29,30)/b28-26+ |
| InChIKey | WBBLIRPKRKYMTD-BYCLXTJYSA-N |
| SMILES | C1CC2=C(C=CC=C2OCC(=O)O)C(=C1)CCON=C(C3=CC=CC=C3)C4=CN=CC=C4 |
