For research use only. Not for therapeutic Use.
(-)-O,O’-Di-p-toluoyl-L-tartaric Acid (Cat.No:R006664) is a chiral resolving agent and a versatile reagent in asymmetric synthesis. Derived from tartaric acid, it’s used to separate enantiomers, aiding in their identification and purification. This compound finds application in various fields, including pharmaceuticals and agrochemicals, due to its chiral recognition properties.
Catalog Number | R006664 |
CAS Number | 32634-66-5 |
Synonyms | O,O’-Di-p-toluoyl-Lg-tartaric Acid; (2R,3R)-(-)-Di-O-4-toluoyltartaric Acid;?(R(R*,R*))-2,3-Bis-[(4-methylbenzoyl)oxy]succinic Acid; |
Molecular Formula | C20H18O8 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R,3R)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid |
InChI | InChI=1S/C20H18O8/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24)/t15-,16-/m1/s1 |
InChIKey | CMIBUZBMZCBCAT-HZPDHXFCSA-N |
SMILES | CC1=CC=C(C=C1)C(=O)OC(C(C(=O)O)OC(=O)C2=CC=C(C=C2)C)C(=O)O |