For research use only. Not for therapeutic Use.
Opevesostat(CAT: I040772) is a selective inhibitor of histone deacetylase 6 (HDAC6), an enzyme involved in the regulation of protein acetylation, particularly in the cytoplasm. HDAC6 plays key roles in protein degradation, cell motility, immune response, and stress granule formation. By inhibiting HDAC6, Opevesostat enhances acetylation of non-histone proteins such as α-tubulin and Hsp90, affecting processes related to cancer progression, neurodegeneration, and inflammation. Opevesostat is being explored for therapeutic potential in oncology and immune-related disorders, and it serves as a valuable research tool for studying HDAC6-specific pathways and their impact on cellular homeostasis.
| CAS Number | 2231294-96-3 |
| Synonyms | 2-(1,3-dihydroisoindol-2-ylmethyl)-5-[(1-methylsulfonylpiperidin-4-yl)methoxy]pyran-4-one |
| Molecular Formula | C21H26N2O5S |
| Purity | ≥95% |
| IUPAC Name | 2-(1,3-dihydroisoindol-2-ylmethyl)-5-[(1-methylsulfonylpiperidin-4-yl)methoxy]pyran-4-one |
| InChI | InChI=1S/C21H26N2O5S/c1-29(25,26)23-8-6-16(7-9-23)14-28-21-15-27-19(10-20(21)24)13-22-11-17-4-2-3-5-18(17)12-22/h2-5,10,15-16H,6-9,11-14H2,1H3 |
| InChIKey | LHVKCOBGLZGRQZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC(CC1)COC2=COC(=CC2=O)CN3CC4=CC=CC=C4C3 |
