For research use only. Not for therapeutic Use.
Opipramol（Cat No.:R007501）is a tricyclic antidepressant (TCA) with unique sigma receptor agonist activity, primarily used to treat generalized anxiety disorder (GAD) and somatic symptom disorders. Unlike classical TCAs, it has minimal effects on serotonin and norepinephrine reuptake but strongly binds to sigma-1 and sigma-2 receptors, modulating stress responses and neuroprotection. Opipramol also exhibits antihistaminergic and anxiolytic properties, contributing to its sedative effects. It is well-tolerated, with side effects such as drowsiness, dizziness, and dry mouth. Its broad neuropsychopharmacological profile makes it a valuable option for chronic anxiety and psychosomatic conditions.
| CAS Number | 315-72-0 |
| Synonyms | 2-[4-(3-benzo[b][1]benzazepin-11-ylpropyl)piperazin-1-yl]ethanol |
| Molecular Formula | C23H29N3O |
| Purity | ≥95% |
| IUPAC Name | 2-[4-(3-benzo[b][1]benzazepin-11-ylpropyl)piperazin-1-yl]ethanol |
| InChI | InChI=1S/C23H29N3O/c27-19-18-25-16-14-24(15-17-25)12-5-13-26-22-8-3-1-6-20(22)10-11-21-7-2-4-9-23(21)26/h1-4,6-11,27H,5,12-19H2 |
| InChIKey | YNZFUWZUGRBMHL-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCN2C3=CC=CC=C3C=CC4=CC=CC=C42)CCO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
