For research use only. Not for therapeutic Use.
Potent and selective inhibitor of catechol-O-methyl-transferase.
| Catalog Number | I010218 |
| CAS Number | 7659-29-2 |
| Synonyms | 3,5-Dinitrocatechol |
| Molecular Formula | C6H4N2O6 |
| Purity | ≥95% |
| Target | Transferase |
| Solubility | Soluble to 100 mM in ethanol and to 100 mM in DMSO |
| Storage | Store at RT |
| IUPAC Name | 3,5-dinitrobenzene-1,2-diol |
| InChI | InChI=1S/C6H4N2O6/c9-5-2-3(7(11)12)1-4(6(5)10)8(13)14/h1-2,9-10H |
| InChIKey | VDCDWNDTNSWDFJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)O)[N+](=O)[O-] |
