For research use only. Not for therapeutic Use.
Orbifloxacin（Cat No.:A000553）is a broad-spectrum fluoroquinolone antibiotic commonly used in veterinary medicine to treat bacterial infections in animals, particularly in dogs and cats. It works by inhibiting bacterial DNA gyrase, essential for DNA replication and cell division, effectively combating both Gram-positive and Gram-negative bacteria. Orbifloxacin is especially useful for treating skin infections, urinary tract infections, and respiratory infections, providing a high bioavailability and excellent tissue penetration. Its once-daily dosing and efficacy make it a preferred choice for veterinarians managing various bacterial infections in companion animals.
| Catalog Number | A000553 |
| CAS Number | 113617-63-3 |
| Synonyms | NA |
| Molecular Formula | C19H20F3N3O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-cyclopropyl-7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-5,6,8-trifluoro-4-oxoquinoline-3-carboxylic acid |
| InChI | InChI=1S/C19H20F3N3O3/c1-8-5-24(6-9(2)23-8)17-14(21)13(20)12-16(15(17)22)25(10-3-4-10)7-11(18(12)26)19(27)28/h7-10,23H,3-6H2,1-2H3,(H,27,28)/t8-,9+ |
| InChIKey | QIPQASLPWJVQMH-DTORHVGOSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](N1)C)C2=C(C3=C(C(=C2F)F)C(=O)C(=CN3C4CC4)C(=O)O)F |
