For research use only. Not for therapeutic Use.
Orelabrutinib (ICP-022) is a potent, orally active, and irreversible Bruton’s tyrosine kinase (BTK) inhibitor with potential antineoplastic activity. Orelabrutinib prevents both the activation of the B-cell antigen receptor (BCR) signaling pathway and BTK-mediated activation of downstream survival pathways, inhibiting the growth of malignant B-cells that overexpress BTK[1][2].
With a proprietary formulation, Orelabrutinib (ICP-022) achieves high bioavailability comparing to other BTK inhibitors[1].
Upon administration, Orelabrutinib (ICP-022) binds to and inhibits the activity of BTK. This prevents both the activation of the B-cell antigen receptor (BCR) signaling pathway and BTK-mediated activation of downstream survival pathways, inhibiting the growth of malignant B-cells that overexpress BTK[2].
| Catalog Number | I015525 |
| CAS Number | 1655504-04-3 |
| Synonyms | 2-(4-phenoxyphenyl)-6-(1-prop-2-enoylpiperidin-4-yl)pyridine-3-carboxamide |
| Molecular Formula | C26H25N3O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C26H25N3O3/c1-2-24(30)29-16-14-18(15-17-29)23-13-12-22(26(27)31)25(28-23)19-8-10-21(11-9-19)32-20-6-4-3-5-7-20/h2-13,18H,1,14-17H2,(H2,27,31) |
| InChIKey | MZPVEMOYADUARK-UHFFFAOYSA-N |
| SMILES | C=CC(=O)N1CCC(CC1)C2=NC(=C(C=C2)C(=O)N)C3=CC=C(C=C3)OC4=CC=CC=C4 |
| Reference | [1]. Wei Xu, et al. Safety, Tolerability and Efficacy of Orelabrutinib, Once a Day, to Treat Chinese Patients with Relapsed or Refractory Chronic Lymphocytic Leukemia/Small Cell Leukemia. Blood (2019) 134 (Supplement_1): 4319. [2]. BTK Inhibitor ICP-022. |
