For research use only. Not for therapeutic Use.
Org30958（Cat No.:I013335）is an investigational small molecule compound that acts as a selective inhibitor of the bromodomain and extraterminal (BET) family of proteins. BET proteins, such as BRD2, BRD3, and BRD4, play a crucial role in regulating gene expression by binding to acetylated lysine residues on histones. By inhibiting BET proteins, Org30958 is studied for its potential to modulate gene expression, particularly in cancer, inflammation, and other diseases where dysregulated transcriptional activity is involved. Research is ongoing to explore its efficacy, safety, and potential therapeutic applications in treating various malignancies and inflammatory disorders.
| Catalog Number | I013335 |
| CAS Number | 99957-90-1 |
| Molecular Formula | C₂₁H₃₀O₂S₂ |
| Purity | ≥95% |
| Target | Cytochrome P450 |
| Solubility | DMSO |
| IUPAC Name | (8S,9S,10S,13S,14S)-10-[(ethyldisulfanyl)methyl]-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| InChI | InChI=1S/C21H30O2S2/c1-3-24-25-13-21-11-8-15(22)12-14(21)4-5-16-17-6-7-19(23)20(17,2)10-9-18(16)21/h12,16-18H,3-11,13H2,1-2H3/t16-,17-,18-,20-,21+/m0/s1 |
| InChIKey | RCEOCOMZMSAAFR-OAGDOXAWSA-N |
| SMILES | CCSSC[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C |
