For research use only. Not for therapeutic Use.
Oridonin(Cat No.:R014796)is a bioactive diterpenoid compound extracted from Rabdosia rubescens, known for its broad pharmacological properties, particularly its anticancer activity. It exerts antitumor effects through multiple mechanisms, including induction of apoptosis, cell cycle arrest, and inhibition of angiogenesis. Oridonin also targets signaling pathways such as NF-κB, MAPK, and PI3K/Akt, contributing to its anti-inflammatory, antioxidant, and antiproliferative activities. In addition to its anticancer properties, oridonin has demonstrated potential in treating inflammatory and microbial diseases. It is widely used in research exploring natural compounds for cancer therapy and immune regulation.
Catalog Number | R014796 |
CAS Number | 28957-04-2 |
Synonyms | (14R)-7α,20-Epoxy-1α,6β,7,14-tetrahydroxy-Kaur-16-en-15-one; Oridonin; 6,11b-(Epoxymethano)-6a,9-methano-1H-cyclohepta[a]naphthalene Kaur-16-en-15-one deriv.; Isodonol; NSC 250682 |
Molecular Formula | C20H28O6 |
Purity | ≥95% |
Target | Anti-infection |
Storage | 3 years -20C powder |
IUPAC Name | (1S,2S,5S,8R,9S,10S,11R,15S,18R)-9,10,15,18-tetrahydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one |
InChI | InChI=1S/C20H28O6/c1-9-10-4-5-11-18-8-26-20(25,19(11,14(9)22)15(10)23)16(24)13(18)17(2,3)7-6-12(18)21/h10-13,15-16,21,23-25H,1,4-8H2,2-3H3/t10-,11-,12-,13+,15+,16-,18+,19-,20+/m0/s1 |
InChIKey | SDHTXBWLVGWJFT-XKCURVIJSA-N |
SMILES | CC1(CC[C@@H]([C@]23[C@@H]1[C@@H]([C@]([C@]45[C@H]2CC[C@H]([C@H]4O)C(=C)C5=O)(OC3)O)O)O)C |