For research use only. Not for therapeutic Use.
Orlistat-d3 is a high-purity deuterated compound crucial for advanced pharmaceutical and biochemical research. This isotopically labeled version of Orlistat, featuring three deuterium atoms, is essential for studies involving fat absorption, obesity treatment, and metabolic pathway analysis. Its stable isotope labeling ensures precise and reliable analytical results, providing enhanced stability and consistency in various experimental setups. Ideal for drug metabolism research and therapeutic development, Orlistat-d3 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | 1356930-46-5 |
Synonyms | N-Formyl-L-leucine (1S)-1-[[(2S,3S)-3-hexyl-4-oxo-2-oxetanyl]methyl]dodecyl Ester-d3; (-)-Tetrahydrolipstatin-d3; Ro 18-0647/002-d3; Tetrahydrolipstatin-d3; Xenical-d3; |
Molecular Formula | C29H53NO5 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | [(2S)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]tridecan-2-yl] (2S)-5,5,5-trideuterio-2-formamido-4-methylpentanoate |
InChI | InChI=1S/C29H53NO5/c1-5-7-9-11-12-13-14-15-16-18-24(34-29(33)26(30-22-31)20-23(3)4)21-27-25(28(32)35-27)19-17-10-8-6-2/h22-27H,5-21H2,1-4H3,(H,30,31)/t24-,25-,26-,27-/m0/s1/i3D3/t23?,24-,25-,26-,27- |
InChIKey | AHLBNYSZXLDEJQ-HDVRVJOHSA-N |
SMILES | [2H]C([2H])([2H])C(C)C[C@@H](C(=O)O[C@@H](CCCCCCCCCCC)C[C@H]1[C@@H](C(=O)O1)CCCCCC)NC=O |