For research use only. Not for therapeutic Use.
Orobol(Cat No.:R044083)is a naturally occurring isoflavone found in soy products, known for its antioxidant, anti-inflammatory, and anticancer properties. It acts as a potent inhibitor of tyrosine kinases, enzymes that play a crucial role in cell signaling pathways involved in cell growth and proliferation. By targeting these kinases, Orobol can disrupt cancer cell proliferation and induce apoptosis. It is widely studied in cancer research for its potential therapeutic applications, particularly in hormone-related cancers. Additionally, Orobol’s antioxidant activity helps mitigate oxidative stress, contributing to its anti-inflammatory benefits in various disease models.
CAS Number | 480-23-9 |
Molecular Formula | C15H10O6 |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Storage | 3 years -20C powder |
IUPAC Name | 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
InChI | InChI=1S/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H |
InChIKey | IOYHCQBYQJQBSK-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O)O |