For research use only. Not for therapeutic Use.
Orotic Acid-15N Monohydrate is a nitrogen-15 labeled form of orotic acid, featuring one 15N atom for enhanced stability and precision in research. This isotopically labeled compound is essential for studying the metabolic pathways, pharmacokinetics, and biochemical roles of orotic acid in nucleotide biosynthesis. Orotic Acid-15N Monohydrate ensures reliable and consistent results in advanced pharmaceutical and biochemical research, making it a valuable tool for scientists and healthcare professionals. Ideal for use in mass spectrometry and NMR spectroscopy, it supports accurate tracking and quantification in various biological systems.
| Catalog Number | R043233 |
| CAS Number | 1229646-87-0 |
| Synonyms | 1,2,3,6-Tetrahydro-2,6-dioxo-4-pyrimidinecarboxylic Acid-15N Monohydrate |
| Molecular Formula | C5H4N2O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
| InChI | InChI=1S/C5H4N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11)/i6+1 |
| InChIKey | PXQPEWDEAKTCGB-PTQBSOBMSA-N |
| SMILES | C1=C(NC(=O)NC1=O)C(=O)O |
