For research use only. Not for therapeutic Use.
Orotic acid (Cat No.:I004483) is an intermediate compound in the metabolic pathway of pyrimidines, which are essential building blocks of DNA and RNA. OA plays a crucial role in the biosynthesis of pyrimidine nucleotides, such as uridine and cytidine, which are necessary for DNA replication and protein synthesis. Additionally, OA is involved in the regulation of cell growth and proliferation. Its availability and proper metabolism are important for normal cellular functions and the maintenance of nucleotide balance in the body.
Catalog Number | I004483 |
CAS Number | 65-86-1 |
Synonyms | 2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
Molecular Formula | C5H4N2O4 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | DMSO: 2 mg/mL, H2O: < 1 mg/mL |
Storage | Room Temperature |
IUPAC Name | 2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
InChI | InChI=1S/C5H4N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11) |
InChIKey | PXQPEWDEAKTCGB-UHFFFAOYSA-N |
SMILES | C1=C(NC(=O)NC1=O)C(=O)O |
Reference | <p style=/line-height:25px/> |