For research use only. Not for therapeutic Use.
Oroxindin (Cat.No:R072750) is a natural compound derived from plants such as Oroxylin A. It exhibits anti-inflammatory, antioxidant, and neuroprotective properties. Oroxindin has been studied for its potential therapeutic applications, including in neurodegenerative disorders and inflammatory diseases. Further research is underway to explore its pharmacological effects and clinical potential.
| Catalog Number | R072750 |
| CAS Number | 51059-44-0 |
| Molecular Formula | C22H20O11 |
| Purity | ≥95% |
| Target | Autophagy |
| Storage | Store at -20°C |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(5-hydroxy-8-methoxy-4-oxo-2-phenylchromen-7-yl)oxyoxane-2-carboxylic acid |
| InChI | InChI=1S/C22H20O11/c1-30-18-13(32-22-17(27)15(25)16(26)20(33-22)21(28)29)8-11(24)14-10(23)7-12(31-19(14)18)9-5-3-2-4-6-9/h2-8,15-17,20,22,24-27H,1H3,(H,28,29)/t15-,16-,17+,20-,22+/m0/s1 |
| InChIKey | LNOHXHDWGCMVCO-NTKSAMNMSA-N |
| SMILES | COC1=C(C=C(C2=C1OC(=CC2=O)C3=CC=CC=C3)O)OC4C(C(C(C(O4)C(=O)O)O)O)O |
