For research use only. Not for therapeutic Use.
ortho-iodoHoechst 33258 (CAT: I002006) is a blue fluorescent dye commonly used for DNA staining. It belongs to the Hoechst family of dyes, which bind to the minor groove of double-stranded DNA. The dye exhibits excitation/emission spectra similar to Hoechst 33342 and is cell-permeable, allowing it to bind to DNA in live or fixed cells. Hoechst dyes have applications in DNA quantitation, fluorescence microscopy, and flow cytometry. They are used in various fields such as molecular biology, genetics, and cell biology to visualize and analyze DNA content, chromatin structure, and cell cycle progression.
| Catalog Number | I002006 |
| CAS Number | 158013-41-3 |
| Synonyms | 2-(2-iodophenyl)-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole |
| Molecular Formula | C25H23IN6 |
| Purity | ≥95% |
| Target | DNA Stain |
| Solubility | 25℃: DMSO or water Protect from light |
| Storage | Store at -20°C |
| IUPAC Name | 2-(2-iodophenyl)-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole |
| InChI | InChI=1S/C25H23IN6/c1-31-10-12-32(13-11-31)17-7-9-21-23(15-17)29-24(27-21)16-6-8-20-22(14-16)30-25(28-20)18-4-2-3-5-19(18)26/h2-9,14-15H,10-13H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | UOHARKYRPCGBEI-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=CC5=C(C=C4)N=C(N5)C6=CC=CC=C6I |
| Reference | <p style=/line-height:25px/> <br>[2]. Latt SA, Stetten G, Juergens LA, Recent developments in the detection of deoxyribonucleic acid synthesis by 33258 Hoechst fluorescence. The journal of histochemistry and cytochemistry : official journal of the Histochemistry Society 23 (7): 493-505. <br>[3]. Portugal J, Waring MJ. Assignment of DNA binding sites for 4/’,6-diamidine-2-phenylindole and bisbenzimide (Hoechst 33258). A comparative footprinting study. Biochimica et Biophysica Acta 949 (2): 158-68. </p> |
