For research use only. Not for therapeutic Use.
Osalmid（Cat No.:I013689）is a compound that specifically targets the small subunit M2 (RRM2) of ribonucleotide reductase. It exerts its action by suppressing the activity of ribonucleotide reductase, an enzyme essential for DNA synthesis. Osalmid demonstrates an inhibitory concentration (IC50) of 8.23 μM against ribonucleotide reductase activity. By targeting RRM2, Osalmid offers potential therapeutic benefits in inhibiting DNA replication and cell proliferation, making it a promising candidate for the treatment of various diseases, including cancer where dysregulated DNA synthesis plays a significant role.
| Catalog Number | I013689 |
| CAS Number | 526-18-1 |
| Molecular Formula | C₁₃H₁₁NO₃ |
| Purity | ≥95% |
| Target | HBV |
| Solubility | DMSO: ≥ 28 mg/mL |
| Storage | Room Temperature |
| IUPAC Name | 2-hydroxy-N-(4-hydroxyphenyl)benzamide |
| InChI | InChI=1S/C13H11NO3/c15-10-7-5-9(6-8-10)14-13(17)11-3-1-2-4-12(11)16/h1-8,15-16H,(H,14,17) |
| InChIKey | LGCMKPRGGJRYGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)O)O |
| Reference | [1]. Liu X, et al. Inhibition of hepatitis B virus replication by targeting ribonucleotide reductase M2 protein. Biochem Pharmacol. 2016 Mar 1;103:118-28. |
