For research use only. Not for therapeutic Use.
OSI-7904L(Cat No.:I008508)is a small molecule inhibitor that targets the enzyme thymidylate synthase (TS), which plays a critical role in DNA synthesis and repair. By inhibiting TS, OSI-7904L disrupts the production of thymidine, a nucleotide essential for DNA replication, ultimately leading to the inhibition of tumor cell growth. It has been studied for its potential as an anticancer agent, particularly in the treatment of solid tumors like colorectal cancer and non-small cell lung cancer. Preclinical and early-phase clinical trials have shown promising activity, but further research is needed to confirm its safety and efficacy in cancer therapy.
CAS Number | 139987-54-5 |
Synonyms | OSI-7904L; OSI7904L; OSI 7904L; GS7904L; GS-7904L; GS 7904L; GW1843; GW-1843; GW 1843; 1843U89; OVI237; OVI-237; OVI 237.;(S)-2-(5-(((3-methyl-1-oxo-1,2-dihydrobenzo[f]quinazolin-9-yl)methyl)amino)-1-oxoisoindolin-2-yl)pentanedioic acid |
Molecular Formula | C27H24N4O6 |
Purity | ≥95% |
Target | thymidylate synthase inhibitor |
Solubility | Soluble in DMSO, not soluble in water. |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | (2S)-2-[6-[(3-methyl-1-oxo-2H-benzo[f]quinazolin-9-yl)methylamino]-3-oxo-1H-isoindol-2-yl]pentanedioic acid |
InChI | InChI=1S/C27H24N4O6/c1-14-29-21-7-4-16-3-2-15(10-20(16)24(21)25(34)30-14)12-28-18-5-6-19-17(11-18)13-31(26(19)35)22(27(36)37)8-9-23(32)33/h2-7,10-11,22,28H,8-9,12-13H2,1H3,(H,32,33)(H,36,37)(H,29,30,34)/t22-/m0/s1 |
InChIKey | BRVFNEZMTRVUGW-QFIPXVFZSA-N |
SMILES | CC1=NC2=C(C3=C(C=CC(=C3)CNC4=CC5=C(C=C4)C(=O)N(C5)[C@@H](CCC(=O)O)C(=O)O)C=C2)C(=O)N1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |