For research use only. Not for therapeutic Use.
OSM-SMI-10B（Cat No.:I041416）is a small-molecule inhibitor that targets the OSM (Oncostatin M) receptor signaling pathway, which is involved in inflammation, immune responses, and tissue remodeling. This compound is being researched for its potential in treating various inflammatory diseases and cancers, as OSM signaling is linked to disease progression in conditions like rheumatoid arthritis and certain cancers. By selectively inhibiting OSM receptor activation, OSM-SMI-10B may help reduce inflammation and prevent tumor growth. Ongoing studies are focused on assessing its efficacy, safety, and therapeutic potential in preclinical models.
| CAS Number | 2502294-55-3 |
| Synonyms | (E)-3-[4,5-bis(1,3-benzodioxol-5-yl)furan-2-yl]prop-2-enoic acid |
| Molecular Formula | C21H14O7 |
| Purity | ≥95% |
| IUPAC Name | (E)-3-[4,5-bis(1,3-benzodioxol-5-yl)furan-2-yl]prop-2-enoic acid |
| InChI | InChI=1S/C21H14O7/c22-20(23)6-3-14-9-15(12-1-4-16-18(7-12)26-10-24-16)21(28-14)13-2-5-17-19(8-13)27-11-25-17/h1-9H,10-11H2,(H,22,23)/b6-3+ |
| InChIKey | KCTZPNCRBRJVBH-ZZXKWVIFSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=C(OC(=C3)/C=C/C(=O)O)C4=CC5=C(C=C4)OCO5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
