For research use only. Not for therapeutic Use.
OSM-SMI-10B a derivative of OSM-SMI-10. OSM-SMI-10B significantly reduces OSM-induced STAT3 phosphorylation in cancer cells upon co-incubation with OSM (Oncostatin M)[1].
| Catalog Number | I041416 |
| Synonyms | (E)-3-[4,5-bis(1,3-benzodioxol-5-yl)furan-2-yl]prop-2-enoic acid |
| Molecular Formula | C21H14O7 |
| Purity | ≥95% |
| InChI | InChI=1S/C21H14O7/c22-20(23)6-3-14-9-15(12-1-4-16-18(7-12)26-10-24-16)21(28-14)13-2-5-17-19(8-13)27-11-25-17/h1-9H,10-11H2,(H,22,23)/b6-3+ |
| InChIKey | KCTZPNCRBRJVBH-ZZXKWVIFSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=C(OC(=C3)C=CC(=O)O)C4=CC5=C(C=C4)OCO5 |
| Reference | [1]. Mass OA, et al. Bioactive recombinant human oncostatin M for NMR-based screening in drug discovery. Sci Rep. 2021 Aug 10;11(1):16174. |
