For research use only. Not for therapeutic Use.
Research chemical ostarine (CAS 841205-47-8) also known as GTx-024 or MK-2866 or enobosarm, is an investigational selective androgen receptor modulator (SARM) for the treatment of conditions such as muscle wasting and osteoporosis. This product is used in medical research and development and other scientific research fields.
| Catalog Number | I005881 |
| CAS Number | 841205-47-8 |
| Synonyms | Ostarine; GTx-024; MK-2866; S-22; VERU-024 |
| Molecular Formula | C19H14F3N3O3 |
| Purity | ≥95% |
| Target | androgen receptor (AR) |
| Solubility | Soluble in DMSO, not in water |
| Storage | Store at +4C |
| IUPAC Name | (2S)-3-(4-cyanophenoxy)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide |
| InChI | InChI=1S/C19H14F3N3O3/c1-18(27,11-28-15-6-2-12(9-23)3-7-15)17(26)25-14-5-4-13(10-24)16(8-14)19(20,21)22/h2-8,27H,11H2,1H3,(H,25,26)/t18-/m0/s1 |
| InChIKey | JNGVJMBLXIUVRD-SFHVURJKSA-N |
| SMILES | O=C(NC1=CC=C(C#N)C(C(F)(F)F)=C1)[C@@](C)(O)COC2=CC=C(C#N)C=C2 |
