For research use only. Not for therapeutic Use.
Osthole (Cat No.:I003705) is a natural coumarin derivative found in various medicinal plants, such as Cnidium monnieri and Angelica pubescent. It has been studied for its pharmacological activities and potential therapeutic effects. Osthole exhibits a wide range of biological properties, including anti-inflammatory, antioxidant, anti-cancer, anti-microbial, anti-osteoporotic, and neuroprotective activities. It has shown potential in the treatment of various conditions, including inflammatory disorders, osteoporosis, cancer, cardiovascular diseases, and neurological disorders. Osthole’s mechanisms of action involve the modulation of multiple signaling pathways and targets within the body. Further research is ongoing to explore its therapeutic applications and potential clinical uses.
Catalog Number | I003705 |
CAS Number | 484-12-8 |
Synonyms | 7-Methoxy-8-(3-methyl-2-butenyl)coumarin;NSC 31868 |
Molecular Formula | C15H16O3 |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | 10 mM in DMSO |
Storage | 3 years -20C powder |
IUPAC Name | 7-methoxy-8-(3-methylbut-2-enyl)chromen-2-one |
InChI | InChI=1S/C15H16O3/c1-10(2)4-7-12-13(17-3)8-5-11-6-9-14(16)18-15(11)12/h4-6,8-9H,7H2,1-3H3 |
InChIKey | MBRLOUHOWLUMFF-UHFFFAOYSA-N |
SMILES | CC(=CCC1=C(C=CC2=C1OC(=O)C=C2)OC)C |
Reference | <p style=/line-height:25px/> |