For research use only. Not for therapeutic Use.
OU749（Cat No.:I011821）is a small molecule inhibitor that targets specific signaling pathways involved in cancer cell growth and survival. It has shown promise in preclinical studies as a potential therapeutic agent for treating various cancers, particularly those resistant to conventional treatments. OU749 works by interfering with key kinases or proteins that contribute to tumor progression, inhibiting their activity and thereby reducing cancer cell proliferation. Ongoing research is focused on evaluating its efficacy, safety, and potential use in combination with other therapies for more effective cancer treatment options.
| Catalog Number | I011821 |
| CAS Number | 519170-13-9 |
| Synonyms | N-[5-[(4-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
| Molecular Formula | C16H15N3O3S2 |
| Purity | ≥95% |
| IUPAC Name | N-[5-[(4-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
| InChI | InChI=1S/C16H15N3O3S2/c1-22-13-9-7-12(8-10-13)11-15-17-18-16(23-15)19-24(20,21)14-5-3-2-4-6-14/h2-10H,11H2,1H3,(H,18,19) |
| InChIKey | QCXWBMZVLJCKHF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CC2=NN=C(S2)NS(=O)(=O)C3=CC=CC=C3 |
